Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7)?

Answer

5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one
5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7) is a crystalline white powder with a molecular weight of approximately 347.24 g/mol. It is slightly soluble in water and more readily soluble in organic solvents like methanol. The compound is relatively stable under normal conditions but can be reactive to strong acids and bases. It exhibits limited solubility in common organic solvents and has a melting point around 220°C. It is also known for its ability to form complexes with various metal ions.

About

CAS No 1447-88-7
English Name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one
Molecular Formula C16H12O6
Molecular Weight 300.27 g/mol
SMILES COC1=C(C2=C(C=C1O)OC(=CC2=O)C3=CC=C(C=C3)O)O
InChIKey IHFBPDAQLQOCBX-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7) typically synthesized?

5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7) is typically synthesiz...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7)?

5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7) is primarily used in t...

Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7)?

When handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methoxy-4H-chromen-4-one (CAS: 1447-88-7), it is c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...