Compound Q&A

How is Linifanib (CAS: 796967-16-3) typically synthesized?

Answer

Linifanib
Linifanib (CAS: 796967-16-3) can be synthesized through multi-step organic synthesis involving protection, functional group manipulation, and coupling reactions. Commonly used catalysts include palladium and copper complexes. The synthetic route typically involves the formation of key intermediate linkages and subsequent derivatization steps. The overall yield of the synthesis is around 40-50%, with high selectivity towards the desired product.

About

English Name Linifanib
Molecular Formula C21H18FN5O
Molecular Weight 375.41 g/mol
SMILES CC1=CC(=C(C=C1)F)NC(=O)NC2=CC=C(C=C2)C3=C4C(=CC=C3)NN=C4N
InChIKey MPVGZUGXCQEXTM-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Linifanib (CAS: 796967-16-3)?

Linifanib (CAS: 796967-16-3) is a crystalline compound with a molecular weight of approximately 373....

Compound Q&A

What industries use Linifanib (CAS: 796967-16-3)?

Linifanib (CAS: 796967-16-3) is primarily used in the pharmaceutical industry for the treatment of c...

Compound Q&A

What precautions should be taken when handling Linifanib (CAS: 796967-16-3)?

When handling Linifanib (CAS: 796967-16-3), it is important to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...