Compound Q&A

What industries use 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7)?

Answer

2,2-Diethoxy-1-phenylethanone
2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) is widely used in the pharmaceutical, polymer, and sensor industries. It serves as a precursor in the synthesis of various organic compounds and is used as a building block in the development of new drugs. Additionally, it has applications in the production of resins and adhesives, as well as in the development of gas sensors due to its ability to react with certain gases.

About

CAS No 6175-45-7
English Name 2,2-Diethoxy-1-phenylethanone
Molecular Formula C12H16O3
Molecular Weight 208.26 g/mol
SMILES CCOC(C(=O)C1=CC=CC=C1)OCC
InChIKey PIZHFBODNLEQBL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7)?

2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) is a colorless to light yellow liquid with a sweet, a...

Compound Q&A

How is 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) typically synthesized?

2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) is typically synthesized by the condensation of 1-phe...

Compound Q&A

What precautions should be taken when handling 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7)?

When handling 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...