Compound Q&A

How is 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) typically synthesized?

Answer

2,2-Diethoxy-1-phenylethanone
2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) is typically synthesized by the condensation of 1-phenylethanoic acid with diethyl oxalate in the presence of a catalytic amount of p-toluenesulfonic acid. The reaction is carried out in anhydrous conditions to ensure high selectivity and yield. The process involves mild heating and stirring to facilitate the reaction, leading to a product with a yield of about 80-90%.

About

CAS No 6175-45-7
English Name 2,2-Diethoxy-1-phenylethanone
Molecular Formula C12H16O3
Molecular Weight 208.26 g/mol
SMILES CCOC(C(=O)C1=CC=CC=C1)OCC
InChIKey PIZHFBODNLEQBL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7)?

2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) is a colorless to light yellow liquid with a sweet, a...

Compound Q&A

What industries use 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7)?

2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7) is widely used in the pharmaceutical, polymer, and se...

Compound Q&A

What precautions should be taken when handling 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7)?

When handling 2,2-Diethoxy-1-phenylethanone (CAS: 6175-45-7), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...