Compound Q&A

What industries use 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6)?

Answer

4,5-Dimethoxy-2-nitrobenzoic acid
4,5-Dimethoxy-2-nitrobenzoic acid finds applications in the pharmaceutical and polymer industries. It is used as a precursor in the synthesis of various medicinal compounds and as a monomer in the production of certain polymers. Additionally, it is utilized in the development of sensors and semiconductors for its specific electronic and chemical properties.

About

CAS No 4998-07-6
English Name 4,5-Dimethoxy-2-nitrobenzoic acid
Molecular Formula C9H9NO6
Molecular Weight 227.17 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OC
InChIKey WWCMFGBGMJAJRX-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6)?

4,5-Dimethoxy-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 24...

Compound Q&A

How is 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6) typically synthesized?

4,5-Dimethoxy-2-nitrobenzoic acid is commonly synthesized via the nitration of 4,5-dimethoxybenzoic ...

Compound Q&A

What precautions should be taken when handling 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6)?

When handling 4,5-Dimethoxy-2-nitrobenzoic acid, appropriate personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...