Compound Q&A

How is 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6) typically synthesized?

Answer

4,5-Dimethoxy-2-nitrobenzoic acid
4,5-Dimethoxy-2-nitrobenzoic acid is commonly synthesized via the nitration of 4,5-dimethoxybenzoic acid. This process involves the use of concentrated nitric acid and concentrated sulfuric acid as the nitrating mixture. The reaction is carried out under controlled conditions to ensure high yield and selectivity.

About

CAS No 4998-07-6
English Name 4,5-Dimethoxy-2-nitrobenzoic acid
Molecular Formula C9H9NO6
Molecular Weight 227.17 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OC
InChIKey WWCMFGBGMJAJRX-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6)?

4,5-Dimethoxy-2-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 24...

Compound Q&A

What industries use 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6)?

4,5-Dimethoxy-2-nitrobenzoic acid finds applications in the pharmaceutical and polymer industries. I...

Compound Q&A

What precautions should be taken when handling 4,5-Dimethoxy-2-nitrobenzoic acid (CAS: 4998-07-6)?

When handling 4,5-Dimethoxy-2-nitrobenzoic acid, appropriate personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...