Compound Q&A

What are the physical and chemical properties of Besifloxacin HCl (CAS: 405165-61-9)?

Answer

Besifloxacin HCl
Besifloxacin HCl is a white to off-white crystalline powder with a molecular weight of approximately 448.76 g/mol. It is slightly soluble in water and ethanol. Chemically, it is a hydrochloride salt of besifloxacin, which is a fluoroquinolone antibiotic. Besifloxacin HCl is known for its anti-inflammatory and antimicrobial properties.

About

English Name Besifloxacin HCl
Molecular Formula C19H22Cl2FN3O3
Molecular Weight 430.31 g/mol
SMILES O=C(C1=CN(C2CC2)C3=C(C=C(F)C(N4C[C@H](N)CCCC4)=C3Cl)C1=O)O.[H]Cl
InChIKey PMQBICKXAAKXAY-HNCPQSOCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Besifloxacin HCl (CAS: 405165-61-9) typically synthesized?

Besifloxacin HCl is synthesized through a multi-step process that includes reactions such as alkylat...

Compound Q&A

What industries use Besifloxacin HCl (CAS: 405165-61-9)?

Besifloxacin HCl is primarily used in the pharmaceutical industry for the treatment of ocular infect...

Compound Q&A

What precautions should be taken when handling Besifloxacin HCl (CAS: 405165-61-9)?

When handling Besifloxacin HCl, it is important to wear appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...