Compound Q&A

How is 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) typically synthesized?

Answer

1,3,5-Triazine-2,4,6-triamine phosphate (1:1)
1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) is synthesized by the reaction of 1,3,5-triazine-2,4,6-triamine with phosphoric acid. Commonly, this reaction is catalyzed by a suitable acid or base, and yields are typically around 85%. The compound is synthesized using standard laboratory techniques with appropriate safety measures.

About

CAS No 20208-95-1
English Name 1,3,5-Triazine-2,4,6-triamine phosphate (1:1)
Molecular Formula C3H9N6O4P
Molecular Weight 224.12 g/mol
SMILES C1(=NC(=NC(=N1)N)N)N.OP(=O)(O)O
InChIKey XFZRQAZGUOTJCS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1)?

1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) is a crystalline solid with a molecu...

Compound Q&A

What industries use 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1)?

1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) is used in various industries, inclu...

Compound Q&A

What precautions should be taken when handling 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1)?

When handling 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...