Compound Q&A

What are the physical and chemical properties of 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1)?

Answer

1,3,5-Triazine-2,4,6-triamine phosphate (1:1)
1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) is a crystalline solid with a molecular weight of approximately 194.15 g/mol. It has low solubility in water and organic solvents. The compound exhibits basic reactivity, reacting readily with acids to form salts. It is stable under normal conditions but should be stored in a dry, cool place away from strong oxidizers.

About

CAS No 20208-95-1
English Name 1,3,5-Triazine-2,4,6-triamine phosphate (1:1)
Molecular Formula C3H9N6O4P
Molecular Weight 224.12 g/mol
SMILES C1(=NC(=NC(=N1)N)N)N.OP(=O)(O)O
InChIKey XFZRQAZGUOTJCS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) typically synthesized?

1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) is synthesized by the reaction of 1,...

Compound Q&A

What industries use 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1)?

1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1) is used in various industries, inclu...

Compound Q&A

What precautions should be taken when handling 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1)?

When handling 1,3,5-Triazine-2,4,6-triamine phosphate (1:1) (CAS: 20208-95-1), it is essential to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...