Compound Q&A

What industries use 4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine (CAS: 38222-83-2)?

Answer

4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine
4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine is utilized in the pharmaceutical industry for the synthesis of certain active pharmaceutical ingredients (APIs) due to its unique chemical properties. It also finds applications in the polymer industry as a stabilizer and in the development of sensors for detecting specific chemical or biological agents. Additionally, it is used in the semiconductor industry as a precursor in the fabrication of electronic materials.

About

CAS No 38222-83-2
English Name 4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine
Molecular Formula C14H23N
Molecular Weight 205.34 g/mol
SMILES CC1=CC(=NC(=C1)C(C)(C)C)C(C)(C)C
InChIKey HVHZEKKZMFRULH-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine (CAS: 38222-83-2)?

4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine is a white crystalline solid with a molecular weight o...

Compound Q&A

How is 4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine (CAS: 38222-83-2) typically synthesized?

4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine can be synthesized via a multi-step process involving ...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine (CAS: 38222-83-2)?

When handling 4-Methyl-2,6-bis(2-methyl-2-propanyl)pyridine, it is crucial to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...