Compound Q&A

How is 2-Methyl-4-nitropyridine (CAS: 13508-96-8) typically synthesized?

Answer

2-Methyl-4-nitropyridine
2-Methyl-4-nitropyridine is commonly synthesized via the nitration of 2-methylpyridine using a mixture of nitric and sulfuric acids. The reaction requires careful control of temperature and stoichiometry to achieve high yields and selectivity. Palladium catalysts are sometimes used to improve the reaction outcome.

About

CAS No 13508-96-8
English Name 2-Methyl-4-nitropyridine
Molecular Formula C6H6N2O2
Molecular Weight 138.12 g/mol
SMILES CC1=NC=CC(=C1)[N+](=O)[O-]
InChIKey HWPIDHRDNNZJSY-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-4-nitropyridine (CAS: 13508-96-8)?

2-Methyl-4-nitropyridine is a crystalline solid with a molecular weight of approximately 171.08 g/mo...

Compound Q&A

What industries use 2-Methyl-4-nitropyridine (CAS: 13508-96-8)?

2-Methyl-4-nitropyridine is utilized in the pharmaceutical industry as an intermediate in drug synth...

Compound Q&A

What precautions should be taken when handling 2-Methyl-4-nitropyridine (CAS: 13508-96-8)?

When handling 2-Methyl-4-nitropyridine, it is essential to use personal protective equipment (PPE) i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...