Compound Q&A

What industries use Iron(2+) diacetate (CAS: 3094-87-9)?

Answer

Iron(2+) diacetate
Iron(2+) diacetate (CAS: 3094-87-9) is used in various industries, including pharmaceuticals for iron fortification, polymers for catalytic reactions, sensors for metal detection, and semiconductors for doping processes. Its versatility makes it a valuable reagent in both research and industrial applications.

About

CAS No 3094-87-9
English Name Iron(2+) diacetate
Molecular Formula C4H6FeO4
Molecular Weight 173.93 g/mol
SMILES CC(=O)[O-].CC(=O)[O-].[Fe+2]
InChIKey LNOZJRCUHSPCDZ-UHFFFAOYSA-L
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iron(2+) diacetate (CAS: 3094-87-9)?

Iron(2+) diacetate (CAS: 3094-87-9) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Iron(2+) diacetate (CAS: 3094-87-9) typically synthesized?

Iron(2+) diacetate (CAS: 3094-87-9) is typically synthesized by reacting iron(II) chloride with acet...

Compound Q&A

What precautions should be taken when handling Iron(2+) diacetate (CAS: 3094-87-9)?

When handling Iron(2+) diacetate (CAS: 3094-87-9), it is important to wear appropriate PPE, includin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...