Compound Q&A

How is Iron(2+) diacetate (CAS: 3094-87-9) typically synthesized?

Answer

Iron(2+) diacetate
Iron(2+) diacetate (CAS: 3094-87-9) is typically synthesized by reacting iron(II) chloride with acetic acid. The reaction is conducted under reflux conditions, and the product is often purified by recrystallization. This process ensures high yield and selectivity, making it a common method in academic and industrial settings.

About

CAS No 3094-87-9
English Name Iron(2+) diacetate
Molecular Formula C4H6FeO4
Molecular Weight 173.93 g/mol
SMILES CC(=O)[O-].CC(=O)[O-].[Fe+2]
InChIKey LNOZJRCUHSPCDZ-UHFFFAOYSA-L
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iron(2+) diacetate (CAS: 3094-87-9)?

Iron(2+) diacetate (CAS: 3094-87-9) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use Iron(2+) diacetate (CAS: 3094-87-9)?

Iron(2+) diacetate (CAS: 3094-87-9) is used in various industries, including pharmaceuticals for iro...

Compound Q&A

What precautions should be taken when handling Iron(2+) diacetate (CAS: 3094-87-9)?

When handling Iron(2+) diacetate (CAS: 3094-87-9), it is important to wear appropriate PPE, includin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...