Compound Q&A

What industries use Atractyloside A (CAS: 126054-77-1)?

Answer

Atractyloside A
Atractyloside A (CAS: 126054-77-1) is primarily used in the pharmaceutical industry due to its potential medicinal properties. It has shown promise in the treatment of diabetes, cardiovascular diseases, and certain types of cancer. Additionally, it finds applications in the food industry as a potential antioxidant and in the development of new sensors and semiconductors.

About

English Name Atractyloside A
Molecular Formula C21H36O10
Molecular Weight 448.5 g/mol
SMILES OC[C@H]1O[C@@H](OC([C@@H]2CC[C@]([C@@H]3[C@@H](C2)[C@](C)(O)C(=O)C3)(O)CO)(C)C)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey QNBLVYVBWDIWDM-BSLJOXIBSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atractyloside A (CAS: 126054-77-1)?

Atractyloside A (CAS: 126054-77-1) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is Atractyloside A (CAS: 126054-77-1) typically synthesized?

Atractyloside A (CAS: 126054-77-1) is typically synthesized through semi-synthetic methods from natu...

Compound Q&A

What precautions should be taken when handling Atractyloside A (CAS: 126054-77-1)?

When handling Atractyloside A (CAS: 126054-77-1), it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...