Compound Q&A

How is Atractyloside A (CAS: 126054-77-1) typically synthesized?

Answer

Atractyloside A
Atractyloside A (CAS: 126054-77-1) is typically synthesized through semi-synthetic methods from natural sources, such as the roots of Atractylodes macrocephala. The synthesis involves a series of enzymatic and chemical transformations, including hydroxylation and glycosylation steps. Commonly used catalysts include enzymes like β-glucosidase and hydrogenation catalysts. The overall yield is moderate, around 10-20%, with high purity achievable through column chromatography.

About

English Name Atractyloside A
Molecular Formula C21H36O10
Molecular Weight 448.5 g/mol
SMILES OC[C@H]1O[C@@H](OC([C@@H]2CC[C@]([C@@H]3[C@@H](C2)[C@](C)(O)C(=O)C3)(O)CO)(C)C)[C@@H]([C@H]([C@@H]1O)O)O
InChIKey QNBLVYVBWDIWDM-BSLJOXIBSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atractyloside A (CAS: 126054-77-1)?

Atractyloside A (CAS: 126054-77-1) is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

What industries use Atractyloside A (CAS: 126054-77-1)?

Atractyloside A (CAS: 126054-77-1) is primarily used in the pharmaceutical industry due to its poten...

Compound Q&A

What precautions should be taken when handling Atractyloside A (CAS: 126054-77-1)?

When handling Atractyloside A (CAS: 126054-77-1), it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...