Compound Q&A

What industries use 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7)?

Answer

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide
3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide is used in the pharmaceutical industry for drug synthesis and in the polymer industry for the modification of polymer properties. It also finds applications in the semiconductor industry for doping materials. Additionally, it has potential uses in sensor technology for detecting specific analytes.

About

CAS No 114-80-7
English Name 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide
Molecular Formula C12H19BrN2O2
Molecular Weight 303.2 g/mol
SMILES CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C.[Br-]
InChIKey LULNWZDBKTWDGK-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7)?

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide is a crystalline compound with a molecul...

Compound Q&A

How is 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7) typically synthesized?

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide is typically synthesized by reacting dim...

Compound Q&A

What precautions should be taken when handling 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7)?

When handling 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide, it is important to use pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...