Compound Q&A

What are the physical and chemical properties of 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7)?

Answer

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide
3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide is a crystalline compound with a molecular weight of approximately 354.37 g/mol. It has a solubility of about 580 mg/L in water. This compound is reactive with strong bases and oxidizers. It is non-flammable but requires proper handling due to its solubility and reactivity.

About

CAS No 114-80-7
English Name 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide
Molecular Formula C12H19BrN2O2
Molecular Weight 303.2 g/mol
SMILES CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C.[Br-]
InChIKey LULNWZDBKTWDGK-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7) typically synthesized?

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide is typically synthesized by reacting dim...

Compound Q&A

What industries use 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7)?

3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide (CAS: 114-80-7)?

When handling 3-[(Dimethylcarbamoyl)oxy]-N,N,N-trimethylanilinium bromide, it is important to use pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...