Compound Q&A

How is Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) typically synthesized?

Answer

Ethyl 5-nitro-1-benzofuran-2-carboxylate
Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) can be synthesized through the nitration of ethyl 1-benzofuran-2-carboxylate followed by purification. This process involves the use of concentrated nitric acid and sulfuric acid as reagents under controlled conditions to achieve high yield and selectivity.

About

CAS No 69604-00-8
English Name Ethyl 5-nitro-1-benzofuran-2-carboxylate
Molecular Formula C11H9NO5
Molecular Weight 235.2 g/mol
SMILES CCOC(=O)C1=CC2=C(O1)C=CC(=C2)[N+](=O)[O-]
InChIKey ATHBGWVHAWGMAL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is a crystalline solid with a molecular w...

Compound Q&A

What industries use Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8)?

When handling Ethyl 5-nitro-1-benzofuran-2-carboxylate (CAS: 69604-00-8), it is essential to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...