Compound Q&A

What industries use 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9)?

Answer

5-Nitro-2-thiophenecarboxylic acid
5-Nitro-2-thiophenecarboxylic acid finds applications in several industries. It is used in the pharmaceutical industry for the synthesis of certain drugs. In the polymer industry, it can be used as a monomer or intermediate. Additionally, it is employed in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 6317-37-9
English Name 5-Nitro-2-thiophenecarboxylic acid
Molecular Formula C5H3NO4S
Molecular Weight 173.15 g/mol
SMILES C1=C(SC(=C1)[N+](=O)[O-])C(=O)O
InChIKey UNEPVPOHGXLUIR-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9)?

5-Nitro-2-thiophenecarboxylic acid is a crystalline compound with a molecular weight of approximatel...

Compound Q&A

How is 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9) typically synthesized?

5-Nitro-2-thiophenecarboxylic acid can be synthesized through the nitration of 2-thiophenecarboxylic...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9)?

When handling 5-Nitro-2-thiophenecarboxylic acid, ensure the use of personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...