Compound Q&A

What are the physical and chemical properties of 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9)?

Answer

5-Nitro-2-thiophenecarboxylic acid
5-Nitro-2-thiophenecarboxylic acid is a crystalline compound with a molecular weight of approximately 202.11 g/mol. It has a solubility of about 2.5 g/L in water at 25°C. The compound is reactive towards nucleophiles and can undergo various chemical transformations. It is also known for its acidic nature, making it useful in various chemical reactions.

About

CAS No 6317-37-9
English Name 5-Nitro-2-thiophenecarboxylic acid
Molecular Formula C5H3NO4S
Molecular Weight 173.15 g/mol
SMILES C1=C(SC(=C1)[N+](=O)[O-])C(=O)O
InChIKey UNEPVPOHGXLUIR-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9) typically synthesized?

5-Nitro-2-thiophenecarboxylic acid can be synthesized through the nitration of 2-thiophenecarboxylic...

Compound Q&A

What industries use 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9)?

5-Nitro-2-thiophenecarboxylic acid finds applications in several industries. It is used in the pharm...

Compound Q&A

What precautions should be taken when handling 5-Nitro-2-thiophenecarboxylic acid (CAS: 6317-37-9)?

When handling 5-Nitro-2-thiophenecarboxylic acid, ensure the use of personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...