Compound Q&A

What industries use 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9)?

Answer

3-Fluorobenzenesulfonyl chloride
3-Fluorobenzenesulfonyl chloride finds applications in various industries, particularly in the pharmaceutical sector for the synthesis of medicinal compounds. It is also used in the polymer industry for modifying polymers and in the semiconductor industry for preparing photoresists. Additionally, it is utilized in sensor technology and chemical research for its reactivity and functionality.

About

CAS No 701-27-9
English Name 3-Fluorobenzenesulfonyl chloride
Molecular Formula C6H4ClFO2S
Molecular Weight 194.61 g/mol
SMILES C1=CC(=CC(=C1)S(=O)(=O)Cl)F
InChIKey OKYSUJVCDXZGKE-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9)?

3-Fluorobenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9) typically synthesized?

3-Fluorobenzenesulfonyl chloride can be synthesized by reacting 3-fluorobenzenesulfonic acid with th...

Compound Q&A

What precautions should be taken when handling 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9)?

When handling 3-Fluorobenzenesulfonyl chloride, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...