Compound Q&A

What are the physical and chemical properties of 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9)?

Answer

3-Fluorobenzenesulfonyl chloride
3-Fluorobenzenesulfonyl chloride is a white crystalline solid with a molecular weight of approximately 190.04 g/mol. It is soluble in organic solvents such as methanol and chloroform. This compound is highly reactive, particularly towards nucleophiles and can undergo sulfonation reactions. It is a key reagent in organic synthesis and chemical research.

About

CAS No 701-27-9
English Name 3-Fluorobenzenesulfonyl chloride
Molecular Formula C6H4ClFO2S
Molecular Weight 194.61 g/mol
SMILES C1=CC(=CC(=C1)S(=O)(=O)Cl)F
InChIKey OKYSUJVCDXZGKE-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9) typically synthesized?

3-Fluorobenzenesulfonyl chloride can be synthesized by reacting 3-fluorobenzenesulfonic acid with th...

Compound Q&A

What industries use 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9)?

3-Fluorobenzenesulfonyl chloride finds applications in various industries, particularly in the pharm...

Compound Q&A

What precautions should be taken when handling 3-Fluorobenzenesulfonyl chloride (CAS: 701-27-9)?

When handling 3-Fluorobenzenesulfonyl chloride, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...