Compound Q&A

What industries use Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7)?

Answer

Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate
Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) is primarily used in the pharmaceutical and polymer industries. It serves as a precursor for the synthesis of various organic compounds and materials. In the pharmaceutical sector, it is utilized in the development of new drug molecules, while in polymers, it can be used as a monomer or crosslinker in the production of advanced materials with specific properties.

About

CAS No 59337-92-7
English Name Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate
Molecular Formula C6H5ClO4S2
Molecular Weight 240.69 g/mol
SMILES COC(=O)C1=C(C=CS1)S(=O)(=O)Cl
InChIKey PJVJBDAUWILEOG-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7)?

Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) is a crystalline solid with a mol...

Compound Q&A

How is Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) typically synthesized?

Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) can be synthesized via the chloro...

Compound Q&A

What precautions should be taken when handling Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7)?

When handling Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7), appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...