Compound Q&A

How is Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) typically synthesized?

Answer

Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate
Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) can be synthesized via the chlorosulfonation of 2-thiophenecarboxylic acid methyl ester using fuming sulfuric acid. The reaction proceeds under reflux conditions, and the yield can be improved by using a catalytic amount of a phase transfer catalyst. The product is then purified by recrystallization from a suitable solvent.

About

CAS No 59337-92-7
English Name Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate
Molecular Formula C6H5ClO4S2
Molecular Weight 240.69 g/mol
SMILES COC(=O)C1=C(C=CS1)S(=O)(=O)Cl
InChIKey PJVJBDAUWILEOG-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7)?

Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) is a crystalline solid with a mol...

Compound Q&A

What industries use Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7)?

Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7) is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7)?

When handling Methyl 3-(chlorosulfonyl)-2-thiophenecarboxylate (CAS: 59337-92-7), appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...