Compound Q&A

What are the physical and chemical properties of Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7)?

Answer

Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine
Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7) is a phosphonate ester derivative of guanosine. It crystallizes in a stable form with a high melting point. The molecular weight is approximately 942.16 g/mol. It has poor water solubility and exhibits low reactivity under normal conditions. This compound is stable under acidic and basic conditions but susceptible to hydrolysis in the presence of moisture.

About

CAS No 56001-37-7
English Name Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine
Molecular Formula C10H14N5Na2O14P3
Molecular Weight 567.14 g/mol
SMILES C1=NC2=C(N1C3C(C(C(O3)COP(=O)([O-])OP(=O)([O-])OP(=O)(O)O)O)O)N=C(NC2=O)N.[Na+].[Na+]
InChIKey FIZIYLKEXVIRHJ-LGVAUZIVSA-L
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7) typically synthesized?

Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7) is synthesize...

Compound Q&A

What industries use Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7)?

Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7) is primarily ...

Compound Q&A

What precautions should be taken when handling Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7)?

When handling Disodium 5'-O-({[(phosphonooxy)phosphinato]oxy}phosphinato)guanosine (CAS: 56001-37-7)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...