Compound Q&A

What industries use (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide (CAS: 27262-40-4)?

Answer

(2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide
(2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the polymer industry as a stabilizer and in the sensor industry for its ability to detect specific chemical compounds. Additionally, it can be used in semiconductors as a dopant. Its versatile chemical properties and reactivity make it valuable in multiple industrial sectors.

About

CAS No 27262-40-4
English Name (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide
Molecular Formula C14H20N2O
Molecular Weight 232.33 g/mol
SMILES CC1=C(C(=CC=C1)C)NC(=O)C2CCCCN2
InChIKey SILRCGDPZGQJOQ-LBPRGKRZSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide (CAS: 27262-40-4)?

(2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide is a white or off-white crystalline solid with a...

Compound Q&A

How is (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide (CAS: 27262-40-4) typically synthesized?

(2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide is synthesized through a multi-step process invo...

Compound Q&A

What precautions should be taken when handling (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide (CAS: 27262-40-4)?

When handling (2S)-N-(2,6-Dimethylphenyl)-2-piperidinecarboxamide, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...