Compound Q&A

What industries use Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9)?

Answer

Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate}
This compound is used in various industries such as pharmaceuticals for its antioxidant properties, in polymers to enhance stability, and in sensors for its reactivity. It also finds applications in semiconductors for its conductivity and in cosmetics for its skin care benefits.

About

CAS No 41484-35-9
English Name Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate}
Molecular Formula C38H58O6S
Molecular Weight 642.94 g/mol
SMILES OC(=O)C(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)CCSCCC(C(=O)O)Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C
InChIKey VFBJXXJYHWLXRM-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9)?

The compound has a crystalline form and a molecular weight of approximately 634.53 g/mol. It is mode...

Compound Q&A

How is Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9) typically synthesized?

This compound is synthesized via a multistep process involving the reaction of 4-hydroxy-3,5-bis(2-m...

Compound Q&A

What precautions should be taken when handling Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9)?

Proper handling of this compound requires the use of personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...