Compound Q&A

What are the physical and chemical properties of Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9)?

Answer

Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate}
The compound has a crystalline form and a molecular weight of approximately 634.53 g/mol. It is moderately soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo hydrolysis. It does not have significant reactivity towards electrophiles, making it suitable for various applications without significant degradation.

About

CAS No 41484-35-9
English Name Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate}
Molecular Formula C38H58O6S
Molecular Weight 642.94 g/mol
SMILES OC(=O)C(Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C)CCSCCC(C(=O)O)Cc1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C
InChIKey VFBJXXJYHWLXRM-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9) typically synthesized?

This compound is synthesized via a multistep process involving the reaction of 4-hydroxy-3,5-bis(2-m...

Compound Q&A

What industries use Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9)?

This compound is used in various industries such as pharmaceuticals for its antioxidant properties, ...

Compound Q&A

What precautions should be taken when handling Sulfanediyldi-2,1-ethanediyl bis{3-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]propanoate} (CAS: 41484-35-9)?

Proper handling of this compound requires the use of personal protective equipment (PPE) such as glo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...