Compound Q&A

What industries use 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0)?

Answer

5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole)
This compound finds applications in the pharmaceutical industry for its potential use in drug formulations, as well as in the polymer industry for its use in the synthesis of certain polymers. It is also used in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 133-04-0
English Name 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole)
Molecular Formula C20H18O6
Molecular Weight 354.36 g/mol
SMILES c1cc2c(cc1[C@@H]3[C@@H]4CO[C@H]([C@@H]4CO3)c5ccc6c(c5)OCO6)OCO2
InChIKey PEYUIKBAABKQKQ-FQZPYLGXSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0)?

The compound has a crystalline form with a molecular weight of approximately 422.18 g/mol. It has go...

Compound Q&A

How is 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0) typically synthesized?

This compound is typically synthesized via a multi-step process involving the reaction of a furan de...

Compound Q&A

What precautions should be taken when handling 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...