Compound Q&A

How is 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0) typically synthesized?

Answer

5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole)
This compound is typically synthesized via a multi-step process involving the reaction of a furan derivative with a benzodioxole compound under mild conditions. The process involves the formation of an intermediate and subsequent ring closing to form the final product. The yield is around 70-80%, and the reaction is carried out in the presence of a mild base.

About

CAS No 133-04-0
English Name 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole)
Molecular Formula C20H18O6
Molecular Weight 354.36 g/mol
SMILES c1cc2c(cc1[C@@H]3[C@@H]4CO[C@H]([C@@H]4CO3)c5ccc6c(c5)OCO6)OCO2
InChIKey PEYUIKBAABKQKQ-FQZPYLGXSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0)?

The compound has a crystalline form with a molecular weight of approximately 422.18 g/mol. It has go...

Compound Q&A

What industries use 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0)?

This compound finds applications in the pharmaceutical industry for its potential use in drug formul...

Compound Q&A

What precautions should be taken when handling 5,5'-(1R,3aS,4S,6aS)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) (CAS: 133-04-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...