Compound Q&A

What industries use Campesterol (CAS: 474-62-4)?

Answer

Campesterol
Campesterol (CAS: 474-62-4) is used in various industries. In the pharmaceutical industry, it is used as a precursor for steroidal drugs. In the polymer industry, it serves as a structural component in some polymers. It is also utilized in the development of sensors and in the semiconductor industry for certain applications due to its unique chemical properties.

About

CAS No 474-62-4
English Name Campesterol
Molecular Formula C28H48O
Molecular Weight 400.69 g/mol
SMILES CC(C)[C@H](C)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
InChIKey SGNBVLSWZMBQTH-PODYLUTMSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Campesterol (CAS: 474-62-4)?

Campesterol (CAS: 474-62-4) is a sterol with a crystalline structure and a molecular weight of appro...

Compound Q&A

How is Campesterol (CAS: 474-62-4) typically synthesized?

Campesterol is typically synthesized from sitosterol via a hydrogenation reaction under pressure and...

Compound Q&A

What precautions should be taken when handling Campesterol (CAS: 474-62-4)?

When handling Campesterol (CAS: 474-62-4), it is important to use personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...