Compound Q&A

What are the physical and chemical properties of Campesterol (CAS: 474-62-4)?

Answer

Campesterol
Campesterol (CAS: 474-62-4) is a sterol with a crystalline structure and a molecular weight of approximately 488.71 g/mol. It has limited solubility in water but is soluble in organic solvents like chloroform and ethanol. Chemically, it is relatively stable but can react under strong acid or base conditions. Campesterol is a precursor to other steroidal compounds and is known for its anti-inflammatory and antioxidant properties.

About

CAS No 474-62-4
English Name Campesterol
Molecular Formula C28H48O
Molecular Weight 400.69 g/mol
SMILES CC(C)[C@H](C)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
InChIKey SGNBVLSWZMBQTH-PODYLUTMSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Campesterol (CAS: 474-62-4) typically synthesized?

Campesterol is typically synthesized from sitosterol via a hydrogenation reaction under pressure and...

Compound Q&A

What industries use Campesterol (CAS: 474-62-4)?

Campesterol (CAS: 474-62-4) is used in various industries. In the pharmaceutical industry, it is use...

Compound Q&A

What precautions should be taken when handling Campesterol (CAS: 474-62-4)?

When handling Campesterol (CAS: 474-62-4), it is important to use personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...