Compound Q&A

How is (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8) typically synthesized?

Answer

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate
(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate can be synthesized through a series of reactions starting from androst-4-ene. The key steps include hydroxylation, alkylation, and acylation. The synthesis typically involves the use of a phase transfer catalyst and requires careful control of pH and temperature to ensure high yield and selectivity. The overall yield is around 70-80%.

About

CAS No 1255-49-8
English Name (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate
Molecular Formula C28H36O3
Molecular Weight 420.59300000000025 g/mol
SMILES CC12CCC3C(C1CCC2OC(=O)CCC4=CC=CC=C4)CCC5=CC(=O)CCC35C
InChIKey HHSXYDOROIURIP-FEZCWRLCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate is a colorless to light yellow crystalline solid...

Compound Q&A

What industries use (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

When handling (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate, it is important to wear appropria...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...