Compound Q&A

How is (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8) typically synthesized?

Answer

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate
(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate can be synthesized through a series of reactions starting from androst-4-ene. The key steps include hydroxylation, alkylation, and acylation. The synthesis typically involves the use of a phase transfer catalyst and requires careful control of pH and temperature to ensure high yield and selectivity. The overall yield is around 70-80%.

About

CAS No 1255-49-8
English Name (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate
Molecular Formula C28H36O3
Molecular Weight 420.59 g/mol
SMILES CC12CCC3C(C1CCC2OC(=O)CCC4=CC=CC=C4)CCC5=CC(=O)CCC35C
InChIKey HHSXYDOROIURIP-FEZCWRLCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate is a colorless to light yellow crystalline solid...

Compound Q&A

What industries use (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

When handling (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...