Compound Q&A

What are the physical and chemical properties of (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

Answer

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate
(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate is a colorless to light yellow crystalline solid with a molecular weight of approximately 338.39 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. The compound is relatively stable under normal conditions but can react with strong acids or bases. It is used in pharmaceutical applications and has a melting point of around 80-82°C.

About

CAS No 1255-49-8
English Name (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate
Molecular Formula C28H36O3
Molecular Weight 420.59 g/mol
SMILES CC12CCC3C(C1CCC2OC(=O)CCC4=CC=CC=C4)CCC5=CC(=O)CCC35C
InChIKey HHSXYDOROIURIP-FEZCWRLCSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8) typically synthesized?

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate can be synthesized through a series of reactions...

Compound Q&A

What industries use (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

(17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate (CAS: 1255-49-8)?

When handling (17beta)-3-Oxoandrost-4-en-17-yl 3-phenylpropanoate, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...