Compound Q&A

What precautions should be taken when handling 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7)?

Answer

6-(Trifluoromethyl)-2-pyridinecarboxylic acid
When handling 6-(Trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The substance should be used in a well-ventilated area or fume hood due to its volatility. In case of a spill, it is recommended to clean up with appropriate absorbent materials and consult the Safety Data Sheet (SDS) for further instructions. Ensure proper storage in a cool, dry place away from oxidizing agents.

About

English Name 6-(Trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CC(=NC(=C1)C(F)(F)F)C(=O)O
InChIKey OKBHXGBLXDNJJD-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7)?

6-(Trifluoromethyl)-2-pyridinecarboxylic acid is a white crystalline solid with a molecular weight o...

Compound Q&A

How is 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7) typically synthesized?

6-(Trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the oxidation of 6-(trifl...

Compound Q&A

What industries use 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7)?

6-(Trifluoromethyl)-2-pyridinecarboxylic acid finds applications in multiple industries including ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...