Compound Q&A

What are the physical and chemical properties of 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7)?

Answer

6-(Trifluoromethyl)-2-pyridinecarboxylic acid
6-(Trifluoromethyl)-2-pyridinecarboxylic acid is a white crystalline solid with a molecular weight of 248.08 g/mol. It has a pKa of 2.9 and is slightly soluble in water. This compound exhibits good stability in neutral and acidic solutions but is reactive in basic conditions. It is commonly used as a precursor in organic synthesis due to its high reactivity and unique electronic properties.

About

English Name 6-(Trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.10799999999995 g/mol
SMILES C1=CC(=NC(=C1)C(F)(F)F)C(=O)O
InChIKey OKBHXGBLXDNJJD-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7) typically synthesized?

6-(Trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via the oxidation of 6-(trifl...

Compound Q&A

What industries use 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7)?

6-(Trifluoromethyl)-2-pyridinecarboxylic acid finds applications in multiple industries including ph...

Compound Q&A

What precautions should be taken when handling 6-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 131747-42-7)?

When handling 6-(Trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear appropriate per...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...