Compound Q&A

What industries use 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5)?

Answer

5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid
5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) finds use in the pharmaceutical industry as a precursor for medicinal compounds. It is also used in the polymer industry for the development of functional polymers and in sensors for its catalytic and reactivity properties. Additionally, it has potential applications in the semiconductor industry due to its electronic properties.

About

English Name 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid
Molecular Formula C10H9N3O2
Molecular Weight 203.2 g/mol
SMILES CC1=CC(=C(C=C1)N2N=CC=N2)C(=O)O
InChIKey SRBAGFIYKNQXDV-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5)?

5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) is a crystalline solid with a mole...

Compound Q&A

How is 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) typically synthesized?

5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) can be synthesized through a multi...

Compound Q&A

What precautions should be taken when handling 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5)?

When handling 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...