Compound Q&A

What are the physical and chemical properties of 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5)?

Answer

5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid
5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) is a crystalline solid with a molecular weight of approximately 220.21 g/mol. It has a solubility of about 50 mg/L in water. The compound is reactive towards nucleophilic substitution and can undergo hydrolysis under basic conditions. It is generally stable under normal storage conditions but should be protected from moisture and heat.

About

English Name 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid
Molecular Formula C10H9N3O2
Molecular Weight 203.2 g/mol
SMILES CC1=CC(=C(C=C1)N2N=CC=N2)C(=O)O
InChIKey SRBAGFIYKNQXDV-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) typically synthesized?

5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) can be synthesized through a multi...

Compound Q&A

What industries use 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5)?

5-Methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5) finds use in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5)?

When handling 5-methyl-2-(2H-1,2,3-triazol-2-yl)benzoic acid (CAS: 956317-36-5), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...