Compound Q&A

What industries use 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7)?

Answer

2-Fluoro-5-nitrobenzoic acid
2-Fluoro-5-nitrobenzoic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for the development of certain types of plastics and in the electronics sector for manufacturing semiconductor materials. Additionally, it has applications in the production of dyes and pigments.

About

CAS No 7304-32-7
English Name 2-Fluoro-5-nitrobenzoic acid
Molecular Formula C7H4FNO4
Molecular Weight 185.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)F
InChIKey ICXSHFWYCHJILC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7)?

2-Fluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 218.07 ...

Compound Q&A

How is 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7) typically synthesized?

2-Fluoro-5-nitrobenzoic acid is typically synthesized via the nitration of 2-fluorobenzoic acid. The...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7)?

When handling 2-Fluoro-5-nitrobenzoic acid, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...