Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7)?

Answer

2-Fluoro-5-nitrobenzoic acid
2-Fluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 218.07 g/mol. It has a solubility of about 4.2 g/L in water. The compound is known for its reactivity, particularly in acid-base reactions and aromatic substitution reactions. It is commonly used in organic synthesis and as an intermediate in the production of various pharmaceuticals and dyes.

About

CAS No 7304-32-7
English Name 2-Fluoro-5-nitrobenzoic acid
Molecular Formula C7H4FNO4
Molecular Weight 185.11 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)F
InChIKey ICXSHFWYCHJILC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7) typically synthesized?

2-Fluoro-5-nitrobenzoic acid is typically synthesized via the nitration of 2-fluorobenzoic acid. The...

Compound Q&A

What industries use 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7)?

2-Fluoro-5-nitrobenzoic acid is primarily used in the pharmaceutical industry as an intermediate in ...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-nitrobenzoic acid (CAS: 7304-32-7)?

When handling 2-Fluoro-5-nitrobenzoic acid, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...