Compound Q&A

What precautions should be taken when handling (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5)?

Answer

(4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid
When handling this compound, it is recommended to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be done in a fume hood to minimize exposure. Spills should be carefully cleaned up with absorbent materials, and the area should be flushed with water to ensure complete removal. Always refer to the Safety Data Sheet (SDS) for detailed information on handling and disposal.

About

CAS No 2591-17-5
English Name (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid
Molecular Formula C11H8N2O3S2
Molecular Weight 280.33 g/mol
SMILES C1C(N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)O
InChIKey BJGNCJDXODQBOB-SSDOTTSWSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5)?

This compound is a solid with a crystalline form. Its molecular weight is approximately 324.33 g/mol...

Compound Q&A

How is (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5) typically synthesized?

This compound is typically synthesized via the condensation of 2-aminobenzothiazole with 2-formylthi...

Compound Q&A

What industries use (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5)?

This compound is used in various industries, including pharmaceuticals for its potential as an antib...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...