Compound Q&A

What industries use (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5)?

Answer

(4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid
This compound is used in various industries, including pharmaceuticals for its potential as an antibacterial agent, in sensors for its ability to detect certain analytes, and in polymer chemistry for its cross-linking properties. It is also explored in semiconductor applications for its electron-donating capabilities.

About

CAS No 2591-17-5
English Name (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid
Molecular Formula C11H8N2O3S2
Molecular Weight 280.33 g/mol
SMILES C1C(N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)O
InChIKey BJGNCJDXODQBOB-SSDOTTSWSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5)?

This compound is a solid with a crystalline form. Its molecular weight is approximately 324.33 g/mol...

Compound Q&A

How is (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5) typically synthesized?

This compound is typically synthesized via the condensation of 2-aminobenzothiazole with 2-formylthi...

Compound Q&A

What precautions should be taken when handling (4S)-2-(6-Hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CAS: 2591-17-5)?

When handling this compound, it is recommended to use personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...