Compound Q&A

What industries use Phloxine B (CAS: 18472-87-2)?

Answer

Phloxine B
Phloxine B is widely used in the textile and dyeing industry for coloring fabrics. It is also employed in pharmaceuticals for coloring medications, in food and cosmetics for coloring purposes, and in the paper industry to enhance the appearance of paper. Additionally, it has applications in the analytical chemistry field for dye-sensitized solar cells and other sensing devices.

About

CAS No 18472-87-2
English Name Phloxine B
Molecular Formula C20H2Br4Cl4Na2O5
Molecular Weight 829.63 g/mol
SMILES Clc1c(Cl)c(Cl)c(c(c1Cl)C(=O)[O-])c1c2cc(Br)c(=O)c(c2oc2c1cc(Br)c(c2Br)[O-])Br.[Na+].[Na+]
InChIKey OOYIOIOOWUGAHD-UHFFFAOYSA-L
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phloxine B (CAS: 18472-87-2)?

Phloxine B is a red azo dye with a molecular weight of approximately 300 g/mol. It is slightly solub...

Compound Q&A

How is Phloxine B (CAS: 18472-87-2) typically synthesized?

Phloxine B is synthesized through the coupling of an aromatic diazonium salt with an azoic aniline. ...

Compound Q&A

What precautions should be taken when handling Phloxine B (CAS: 18472-87-2)?

When handling Phloxine B, proper personal protective equipment (PPE) should be worn, including glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...