Compound Q&A

What are the physical and chemical properties of Phloxine B (CAS: 18472-87-2)?

Answer

Phloxine B
Phloxine B is a red azo dye with a molecular weight of approximately 300 g/mol. It is slightly soluble in water and has good light stability. Chemically, it is stable under normal conditions but can react with strong reducing agents. Phloxine B is often used in acidic solutions and has a pKa of about 6.5.

About

CAS No 18472-87-2
English Name Phloxine B
Molecular Formula C20H2Br4Cl4Na2O5
Molecular Weight 829.63 g/mol
SMILES Clc1c(Cl)c(Cl)c(c(c1Cl)C(=O)[O-])c1c2cc(Br)c(=O)c(c2oc2c1cc(Br)c(c2Br)[O-])Br.[Na+].[Na+]
InChIKey OOYIOIOOWUGAHD-UHFFFAOYSA-L
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Phloxine B (CAS: 18472-87-2) typically synthesized?

Phloxine B is synthesized through the coupling of an aromatic diazonium salt with an azoic aniline. ...

Compound Q&A

What industries use Phloxine B (CAS: 18472-87-2)?

Phloxine B is widely used in the textile and dyeing industry for coloring fabrics. It is also employ...

Compound Q&A

What precautions should be taken when handling Phloxine B (CAS: 18472-87-2)?

When handling Phloxine B, proper personal protective equipment (PPE) should be worn, including glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...