Compound Q&A

What precautions should be taken when handling [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3)?

Answer

[3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (1:1:1)
When handling [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up immediately, and proper disposal methods should be followed. Always consult the Safety Data Sheet (SDS) for detailed handling and safety information.

About

CAS No 27710-82-3
English Name [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (1:1:1)
Molecular Formula C23H28Br2NP
Molecular Weight 509.3 g/mol
SMILES CN(C)CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.Br.[Br-]
InChIKey NEQVFHFOWYYPBS-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3)?

The compound [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3) ...

Compound Q&A

How is [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3) typically synthesized?

This compound is typically synthesized through a multi-step process involving the reaction of triphe...

Compound Q&A

What industries use [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3)?

This compound finds applications in various industries due to its unique chemical properties. It is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...