Compound Q&A

How is [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3) typically synthesized?

Answer

[3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (1:1:1)
This compound is typically synthesized through a multi-step process involving the reaction of triphenylphosphine with dimethylamine and bromine. The synthesis involves maintaining appropriate temperature and stirring conditions to ensure the desired yield and selectivity. The use of a suitable catalyst can improve the reaction efficiency, leading to a high purity product.

About

CAS No 27710-82-3
English Name [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (1:1:1)
Molecular Formula C23H28Br2NP
Molecular Weight 509.3 g/mol
SMILES CN(C)CCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.Br.[Br-]
InChIKey NEQVFHFOWYYPBS-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3)?

The compound [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3) ...

Compound Q&A

What industries use [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3)?

This compound finds applications in various industries due to its unique chemical properties. It is ...

Compound Q&A

What precautions should be taken when handling [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3)?

When handling [3-(Dimethylamino)propyl](triphenyl)phosphonium bromide hydrobromide (CAS: 27710-82-3)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...