Compound Q&A

What industries use 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0)?

Answer

4'-Methyl-2-biphenylcarboxylic acid
4'-Methyl-2-biphenylcarboxylic acid is used in various industries, including pharmaceuticals, where it serves as a precursor for drug synthesis. It is also used in the production of polymers, particularly in the development of thermoplastics and thermosetting resins. Additionally, it has applications in the semiconductor industry, where it is used in the fabrication of electronic components, and in the manufacturing of sensors.

About

CAS No 7148-03-0
English Name 4'-Methyl-2-biphenylcarboxylic acid
Molecular Formula C14H12O2
Molecular Weight 212.25 g/mol
SMILES CC1=CC=C(C=C1)C2=CC=CC=C2C(=O)O
InChIKey ZSTUEICKYWFYIC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0)?

4'-Methyl-2-biphenylcarboxylic acid has a crystalline form with a molecular weight of approximately ...

Compound Q&A

How is 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0) typically synthesized?

4'-Methyl-2-biphenylcarboxylic acid is typically synthesized by the condensation of 4-methylbiphenyl...

Compound Q&A

What precautions should be taken when handling 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0)?

When handling 4'-Methyl-2-biphenylcarboxylic acid, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...