Compound Q&A

How is 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0) typically synthesized?

Answer

4'-Methyl-2-biphenylcarboxylic acid
4'-Methyl-2-biphenylcarboxylic acid is typically synthesized by the condensation of 4-methylbiphenyl with acetic anhydride in the presence of an acid catalyst. The reaction is carried out at elevated temperatures, and the yield is generally high, with good selectivity towards the desired product. This method provides a practical route to the compound.

About

CAS No 7148-03-0
English Name 4'-Methyl-2-biphenylcarboxylic acid
Molecular Formula C14H12O2
Molecular Weight 212.25 g/mol
SMILES CC1=CC=C(C=C1)C2=CC=CC=C2C(=O)O
InChIKey ZSTUEICKYWFYIC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0)?

4'-Methyl-2-biphenylcarboxylic acid has a crystalline form with a molecular weight of approximately ...

Compound Q&A

What industries use 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0)?

4'-Methyl-2-biphenylcarboxylic acid is used in various industries, including pharmaceuticals, where ...

Compound Q&A

What precautions should be taken when handling 4'-Methyl-2-biphenylcarboxylic acid (CAS: 7148-03-0)?

When handling 4'-Methyl-2-biphenylcarboxylic acid, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...