Compound Q&A

How is Progesterone Acetate (CAS: 302-23-8) typically synthesized?

Answer

Progesterone Acetate
Progesterone Acetate is synthesized by the acetylation of progesterone. The acetylation is typically catalyzed by acetic anhydride and a strong base such as sodium hydroxide. The reaction is carried out in an organic solvent like dichloromethane. The yield is usually around 85-90%, and the reaction is selective for the acetylation of progesterone.

About

CAS No 302-23-8
English Name Progesterone Acetate
Molecular Formula C23H32O4
Molecular Weight 372.51 g/mol
SMILES CC(=O)C1(CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)OC(=O)C
InChIKey VTHUYJIXSMGYOQ-KOORYGTMSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Progesterone Acetate (CAS: 302-23-8)?

Progesterone Acetate is a white to off-white crystalline powder. It has a molecular weight of approx...

Compound Q&A

What industries use Progesterone Acetate (CAS: 302-23-8)?

Progesterone Acetate is primarily used in the pharmaceutical industry for the production of contrace...

Compound Q&A

What precautions should be taken when handling Progesterone Acetate (CAS: 302-23-8)?

Progesterone Acetate should be handled in a well-ventilated area and with proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...