Compound Q&A

How is Alogliptin Impurity 5 (CAS: 216854-23-8) typically synthesized?

Answer

Alogliptin Impurity 5
Alogliptin Impurity 5 is synthesized via a multi-step process that includes condensation, reduction, and purification steps. Common catalysts include palladium and copper complexes. The synthesis typically yields around 80-85% purity, with selectivity towards the desired impurity profile.

About

English Name Alogliptin Impurity 5
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)N[C@H]1CCCNC1
InChIKey WUOQXNWMYLFAHT-QMMMGPOBSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alogliptin Impurity 5 (CAS: 216854-23-8)?

Alogliptin Impurity 5 is a crystalline solid with a molecular weight of approximately 308.31 g/mol. ...

Compound Q&A

What industries use Alogliptin Impurity 5 (CAS: 216854-23-8)?

Alogliptin Impurity 5 is primarily used in the pharmaceutical industry for research purposes, partic...

Compound Q&A

What precautions should be taken when handling Alogliptin Impurity 5 (CAS: 216854-23-8)?

When handling Alogliptin Impurity 5, it is important to use appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...